C14H14O4 — CID 14164941
(1R,9R,11R,14S)-9,14-dimethyl-4,12-dioxatetracyclo[9.2.1.01,9.03,7]tetradeca-3(7),5-diene-8,13-dione (PubChem CID 14164941) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is (1R,9R,11R,14S)-9,14-dimethyl-4,12-dioxatetracyclo[9.2.1.01,9.03,7]tetradeca-3(7),5-diene-8,13-dione.
| Compound Name | (1R,9R,11R,14S)-9,14-dimethyl-4,12-dioxatetracyclo[9.2.1.01,9.03,7]tetradeca-3(7),5-diene-8,13-dione |
|---|---|
| PubChem CID | 14164941 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (1R,9R,11R,14S)-9,14-dimethyl-4,12-dioxatetracyclo[9.2.1.01,9.03,7]tetradeca-3(7),5-diene-8,13-dione |
| SMILES | C[C@@H]1[C@H]2C[C@@]3(C)C(=O)c4ccoc4C[C@@]13C(=O)O2 |
| InChI | InChI=1S/C14H14O4/c1-7-9-5-13(2)11(15)8-3-4-17-10(8)6-14(7,13)12(16)18-9/h3-4,7,9H,5-6H2,1-2H3/t7-,9-,13+,14+/m1/s1 |
| InChIKey | VELKOVXJPRJRNU-FFQAGHOLSA-N |
| XLogP | 1.98 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |