C10H11BrO2 — CID 107003890
(3-bromofuran-2-yl)-(2,2-dimethylcyclopropyl)methanone (PubChem CID 107003890) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(2,2-dimethylcyclopropyl)methanone.
| Compound Name | (3-bromofuran-2-yl)-(2,2-dimethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 107003890 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | (3-bromofuran-2-yl)-(2,2-dimethylcyclopropyl)methanone |
| SMILES | CC1(C)CC1C(=O)c1occc1Br |
| InChI | InChI=1S/C10H11BrO2/c1-10(2)5-6(10)8(12)9-7(11)3-4-13-9/h3-4,6H,5H2,1-2H3 |
| InChIKey | MGVGDONSQRDEKK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |