About (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone
(3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone (PubChem CID 130992583) has the molecular formula C9H7BrF2O2
and a molecular weight of 265.05 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone.
Molecular Properties
| Compound Name | (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone |
| PubChem CID | 130992583 |
| Molecular Formula | C9H7BrF2O2 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone |
| SMILES | O=C(c1occc1Br)C1CC(F)(F)C1 |
| InChI | InChI=1S/C9H7BrF2O2/c10-6-1-2-14-8(6)7(13)5-3-9(11,12)4-5/h1-2,5H,3-4H2 |
| InChIKey | LWFGWLDYOMLXDY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone?
The IUPAC name of (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone (CID 130992583) is (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone.
What is the SMILES notation for (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone?
The canonical SMILES for (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone is O=C(c1occc1Br)C1CC(F)(F)C1.
What is the InChIKey of (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone?
The InChIKey is LWFGWLDYOMLXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrF2O2/c10-6-1-2-14-8(6)7(13)5-3-9(11,12)4-5/h1-2,5H,3-4H2.
What are the key properties of (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone?
(3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone has a molecular weight of 265.05 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromofuran-2-yl)-(3,3-difluorocyclobutyl)methanone is sourced from PubChem (CID 130992583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).