C14H11BrO2 — CID 65406476
(3-bromofuran-2-yl)-(2,3-dihydro-1H-inden-1-yl)methanone (PubChem CID 65406476) has the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(2,3-dihydro-1H-inden-1-yl)methanone.
| Compound Name | (3-bromofuran-2-yl)-(2,3-dihydro-1H-inden-1-yl)methanone |
|---|---|
| PubChem CID | 65406476 |
| Molecular Formula | C14H11BrO2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | (3-bromofuran-2-yl)-(2,3-dihydro-1H-inden-1-yl)methanone |
| SMILES | O=C(c1occc1Br)C1CCc2ccccc21 |
| InChI | InChI=1S/C14H11BrO2/c15-12-7-8-17-14(12)13(16)11-6-5-9-3-1-2-4-10(9)11/h1-4,7-8,11H,5-6H2 |
| InChIKey | UDCNAKSRNFBBMM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |