C9H11NO2 — CID 82414662
7-methyl-5,6,7,8-tetrahydrofuro[2,3-d]azepin-4-one (PubChem CID 82414662) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 7-methyl-5,6,7,8-tetrahydrofuro[2,3-d]azepin-4-one.
| Compound Name | 7-methyl-5,6,7,8-tetrahydrofuro[2,3-d]azepin-4-one |
|---|---|
| PubChem CID | 82414662 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 7-methyl-5,6,7,8-tetrahydrofuro[2,3-d]azepin-4-one |
| SMILES | CC1Cc2occc2C(=O)CN1 |
| InChI | InChI=1S/C9H11NO2/c1-6-4-9-7(2-3-12-9)8(11)5-10-6/h2-3,6,10H,4-5H2,1H3 |
| InChIKey | LGSQQQKHJZQOAH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |