About 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine
4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine (PubChem CID 82417304) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine.
Analyze 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine?
The IUPAC name of 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine (CID 82417304) is 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine.
What is the SMILES notation for 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine?
The canonical SMILES for 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine is CC1CNCCc2occc21.
What is the InChIKey of 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine?
The InChIKey is SGVPREDHCNTKBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-7-6-10-4-2-9-8(7)3-5-11-9/h3,5,7,10H,2,4,6H2,1H3.
What are the key properties of 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine?
4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine has a molecular weight of 151.21 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5,6,7,8-tetrahydro-4H-furo[2,3-d]azepine is sourced from PubChem (CID 82417304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).