About 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine
4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine (PubChem CID 13143617) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine.
Analyze 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine?
The IUPAC name of 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine (CID 13143617) is 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine.
What is the SMILES notation for 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine?
The canonical SMILES for 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine is CC1CNC(C)c2occc21.
What is the InChIKey of 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine?
The InChIKey is INJKQJNPYFVYMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-6-5-10-7(2)9-8(6)3-4-11-9/h3-4,6-7,10H,5H2,1-2H3.
What are the key properties of 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine?
4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine has a molecular weight of 151.21 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-4,5,6,7-tetrahydrofuro[2,3-c]pyridine is sourced from PubChem (CID 13143617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).