About N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine
N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine (PubChem CID 112714136) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine.
Analyze N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine?
The IUPAC name of N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine (CID 112714136) is N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine.
What is the SMILES notation for N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine?
The canonical SMILES for N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine is CNC1c2occc2CC1C.
What is the InChIKey of N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine?
The InChIKey is SQZBXTJJTKNLDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-6-5-7-3-4-11-9(7)8(6)10-2/h3-4,6,8,10H,5H2,1-2H3.
What are the key properties of N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine?
N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine has a molecular weight of 151.21 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-5,6-dihydro-4H-cyclopenta[b]furan-6-amine is sourced from PubChem (CID 112714136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).