C13H22N2O2 — CID 66245971
N-methyl-4-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]oxolan-3-amine (PubChem CID 66245971) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-methyl-4-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]oxolan-3-amine.
| Compound Name | N-methyl-4-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 66245971 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N-methyl-4-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]oxolan-3-amine |
| SMILES | CNC1COCC1CN(C)Cc1ccoc1C |
| InChI | InChI=1S/C13H22N2O2/c1-10-11(4-5-17-10)6-15(3)7-12-8-16-9-13(12)14-2/h4-5,12-14H,6-9H2,1-3H3 |
| InChIKey | IJZRNZLHCDRQFI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |