C17H30N2O — CID 62707768
2-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]-4-propan-2-ylcyclohexan-1-amine (PubChem CID 62707768) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]-4-propan-2-ylcyclohexan-1-amine.
| Compound Name | 2-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]-4-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 62707768 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]-4-propan-2-ylcyclohexan-1-amine |
| SMILES | Cc1occc1CN(C)CC1CC(C(C)C)CCC1N |
| InChI | InChI=1S/C17H30N2O/c1-12(2)14-5-6-17(18)16(9-14)11-19(4)10-15-7-8-20-13(15)3/h7-8,12,14,16-17H,5-6,9-11,18H2,1-4H3 |
| InChIKey | HCEWVRWDBIWVOK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |