C12H20N2O — CID 81170245
1-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]cyclobutan-1-amine (PubChem CID 81170245) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]cyclobutan-1-amine.
| Compound Name | 1-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 81170245 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]cyclobutan-1-amine |
| SMILES | Cc1occc1CN(C)CC1(N)CCC1 |
| InChI | InChI=1S/C12H20N2O/c1-10-11(4-7-15-10)8-14(2)9-12(13)5-3-6-12/h4,7H,3,5-6,8-9,13H2,1-2H3 |
| InChIKey | UOQIBDIZFWPGHW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |