C16H26BrNO — CID 65010470
N-[[1-(bromomethyl)cycloheptyl]methyl]-N-methyl-1-(2-methylfuran-3-yl)methanamine (PubChem CID 65010470) has the molecular formula C16H26BrNO and a molecular weight of 328.29 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cycloheptyl]methyl]-N-methyl-1-(2-methylfuran-3-yl)methanamine.
| Compound Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-N-methyl-1-(2-methylfuran-3-yl)methanamine |
|---|---|
| PubChem CID | 65010470 |
| Molecular Formula | C16H26BrNO |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-N-methyl-1-(2-methylfuran-3-yl)methanamine |
| SMILES | Cc1occc1CN(C)CC1(CBr)CCCCCC1 |
| InChI | InChI=1S/C16H26BrNO/c1-14-15(7-10-19-14)11-18(2)13-16(12-17)8-5-3-4-6-9-16/h7,10H,3-6,8-9,11-13H2,1-2H3 |
| InChIKey | XKVWYFHQPHETLC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|