C17H25Br2N — CID 65010325
N-[[1-(bromomethyl)cycloheptyl]methyl]-1-(2-bromophenyl)-N-methylmethanamine (PubChem CID 65010325) has the molecular formula C17H25Br2N and a molecular weight of 403.20 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cycloheptyl]methyl]-1-(2-bromophenyl)-N-methylmethanamine.
| Compound Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-1-(2-bromophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 65010325 |
| Molecular Formula | C17H25Br2N |
| Molecular Weight | 403.20 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-1-(2-bromophenyl)-N-methylmethanamine |
| SMILES | CN(Cc1ccccc1Br)CC1(CBr)CCCCCC1 |
| InChI | InChI=1S/C17H25Br2N/c1-20(12-15-8-4-5-9-16(15)19)14-17(13-18)10-6-2-3-7-11-17/h4-5,8-9H,2-3,6-7,10-14H2,1H3 |
| InChIKey | PBNWQFCKXPBODJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.20 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|