C13H19Br2NS — CID 65002893
N-[[1-(bromomethyl)cyclopentyl]methyl]-1-(5-bromothiophen-3-yl)-N-methylmethanamine (PubChem CID 65002893) has the molecular formula C13H19Br2NS and a molecular weight of 381.18 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclopentyl]methyl]-1-(5-bromothiophen-3-yl)-N-methylmethanamine.
| Compound Name | N-[[1-(bromomethyl)cyclopentyl]methyl]-1-(5-bromothiophen-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 65002893 |
| Molecular Formula | C13H19Br2NS |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | N-[[1-(bromomethyl)cyclopentyl]methyl]-1-(5-bromothiophen-3-yl)-N-methylmethanamine |
| SMILES | CN(Cc1csc(Br)c1)CC1(CBr)CCCC1 |
| InChI | InChI=1S/C13H19Br2NS/c1-16(7-11-6-12(15)17-8-11)10-13(9-14)4-2-3-5-13/h6,8H,2-5,7,9-10H2,1H3 |
| InChIKey | SFQJVRNCJAXJLM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|