C11H16BrNO2S — CID 111976688
[3-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]oxetan-3-yl]methanol (PubChem CID 111976688) has the molecular formula C11H16BrNO2S and a molecular weight of 306.22 g/mol. Its IUPAC name is [3-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]oxetan-3-yl]methanol.
| Compound Name | [3-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 111976688 |
| Molecular Formula | C11H16BrNO2S |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | [3-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]oxetan-3-yl]methanol |
| SMILES | CN(Cc1csc(Br)c1)CC1(CO)COC1 |
| InChI | InChI=1S/C11H16BrNO2S/c1-13(3-9-2-10(12)16-4-9)5-11(6-14)7-15-8-11/h2,4,14H,3,5-8H2,1H3 |
| InChIKey | SABRMBAJYJHMRP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |