C13H25N3O — CID 55089418
N',N'-dimethyl-N-[2-[methyl-[(2-methylfuran-3-yl)methyl]amino]ethyl]ethane-1,2-diamine (PubChem CID 55089418) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[methyl-[(2-methylfuran-3-yl)methyl]amino]ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[methyl-[(2-methylfuran-3-yl)methyl]amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 55089418 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | N',N'-dimethyl-N-[2-[methyl-[(2-methylfuran-3-yl)methyl]amino]ethyl]ethane-1,2-diamine |
| SMILES | Cc1occc1CN(C)CCNCCN(C)C |
| InChI | InChI=1S/C13H25N3O/c1-12-13(5-10-17-12)11-16(4)9-7-14-6-8-15(2)3/h5,10,14H,6-9,11H2,1-4H3 |
| InChIKey | BTKJCIJECUPBRN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|