C14H19BrN2OS — CID 62557238
N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine (PubChem CID 62557238) has the molecular formula C14H19BrN2OS and a molecular weight of 343.29 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62557238 |
| Molecular Formula | C14H19BrN2OS |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine |
| SMILES | Cc1occc1CN(C)CCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C14H19BrN2OS/c1-11-12(3-6-18-11)9-17(2)5-4-16-8-14-7-13(15)10-19-14/h3,6-7,10,16H,4-5,8-9H2,1-2H3 |
| InChIKey | XWJZJZNNPPZWOB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|