C13H17BrN2S2 — CID 62560033
N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine (PubChem CID 62560033) has the molecular formula C13H17BrN2S2 and a molecular weight of 345.33 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62560033 |
| Molecular Formula | C13H17BrN2S2 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCc1cc(Br)cs1)Cc1ccsc1 |
| InChI | InChI=1S/C13H17BrN2S2/c1-16(8-11-2-5-17-9-11)4-3-15-7-13-6-12(14)10-18-13/h2,5-6,9-10,15H,3-4,7-8H2,1H3 |
| InChIKey | OAPCVRABALFBDX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|