C13H23BrN2S — CID 62561559
N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-pentan-3-ylethane-1,2-diamine (PubChem CID 62561559) has the molecular formula C13H23BrN2S and a molecular weight of 319.31 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-pentan-3-ylethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-pentan-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62561559 |
| Molecular Formula | C13H23BrN2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-pentan-3-ylethane-1,2-diamine |
| SMILES | CCC(CC)N(C)CCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C13H23BrN2S/c1-4-12(5-2)16(3)7-6-15-9-13-8-11(14)10-17-13/h8,10,12,15H,4-7,9H2,1-3H3 |
| InChIKey | NPNVOPBQOLNTFR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|