C13H21BrN2S — CID 63939322
N-[(4-bromothiophen-2-yl)methyl]-N'-(cyclopropylmethyl)-N'-ethylethane-1,2-diamine (PubChem CID 63939322) has the molecular formula C13H21BrN2S and a molecular weight of 317.30 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-(cyclopropylmethyl)-N'-ethylethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-(cyclopropylmethyl)-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63939322 |
| Molecular Formula | C13H21BrN2S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-(cyclopropylmethyl)-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCNCc1cc(Br)cs1)CC1CC1 |
| InChI | InChI=1S/C13H21BrN2S/c1-2-16(9-11-3-4-11)6-5-15-8-13-7-12(14)10-17-13/h7,10-11,15H,2-6,8-9H2,1H3 |
| InChIKey | TUVICEGTGKYZHA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|