C14H26BrN3S — CID 55090281
N'-[(4-bromothiophen-2-yl)methyl]-N-[2-(diethylamino)ethyl]-N'-methylethane-1,2-diamine (PubChem CID 55090281) has the molecular formula C14H26BrN3S and a molecular weight of 348.35 g/mol. Its IUPAC name is N'-[(4-bromothiophen-2-yl)methyl]-N-[2-(diethylamino)ethyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[(4-bromothiophen-2-yl)methyl]-N-[2-(diethylamino)ethyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 55090281 |
| Molecular Formula | C14H26BrN3S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N'-[(4-bromothiophen-2-yl)methyl]-N-[2-(diethylamino)ethyl]-N'-methylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCN(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C14H26BrN3S/c1-4-18(5-2)9-7-16-6-8-17(3)11-14-10-13(15)12-19-14/h10,12,16H,4-9,11H2,1-3H3 |
| InChIKey | YRAFSWUJIIFCRZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|