C12H21BrN2S — CID 62430991
N'-[(4-bromothiophen-2-yl)methyl]-N-ethyl-N'-methylbutane-1,4-diamine (PubChem CID 62430991) has the molecular formula C12H21BrN2S and a molecular weight of 305.28 g/mol. Its IUPAC name is N'-[(4-bromothiophen-2-yl)methyl]-N-ethyl-N'-methylbutane-1,4-diamine.
| Compound Name | N'-[(4-bromothiophen-2-yl)methyl]-N-ethyl-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 62430991 |
| Molecular Formula | C12H21BrN2S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N'-[(4-bromothiophen-2-yl)methyl]-N-ethyl-N'-methylbutane-1,4-diamine |
| SMILES | CCNCCCCN(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C12H21BrN2S/c1-3-14-6-4-5-7-15(2)9-12-8-11(13)10-16-12/h8,10,14H,3-7,9H2,1-2H3 |
| InChIKey | HDTYXVQJNVCCIU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|