C8H10BrNOS — CID 62053063
2-[(4-bromothiophen-2-yl)methyl-methylamino]acetaldehyde (PubChem CID 62053063) has the molecular formula C8H10BrNOS and a molecular weight of 248.14 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl-methylamino]acetaldehyde.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl-methylamino]acetaldehyde |
|---|---|
| PubChem CID | 62053063 |
| Molecular Formula | C8H10BrNOS |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl-methylamino]acetaldehyde |
| SMILES | CN(CC=O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C8H10BrNOS/c1-10(2-3-11)5-8-4-7(9)6-12-8/h3-4,6H,2,5H2,1H3 |
| InChIKey | NTUXBUFDFHYBKN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|