C15H15Br2NOS — CID 63482092
1-(4-bromophenyl)-3-[(4-bromothiophen-2-yl)methyl-methylamino]propan-1-one (PubChem CID 63482092) has the molecular formula C15H15Br2NOS and a molecular weight of 417.17 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(4-bromothiophen-2-yl)methyl-methylamino]propan-1-one.
| Compound Name | 1-(4-bromophenyl)-3-[(4-bromothiophen-2-yl)methyl-methylamino]propan-1-one |
|---|---|
| PubChem CID | 63482092 |
| Molecular Formula | C15H15Br2NOS |
| Molecular Weight | 417.17 g/mol |
| Exact Mass | 414.92 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(4-bromothiophen-2-yl)methyl-methylamino]propan-1-one |
| SMILES | CN(CCC(=O)c1ccc(Br)cc1)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C15H15Br2NOS/c1-18(9-14-8-13(17)10-20-14)7-6-15(19)11-2-4-12(16)5-3-11/h2-5,8,10H,6-7,9H2,1H3 |
| InChIKey | LPRDOGMRMXQJIL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.17 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |