C15H15BrClNOS — CID 62642965
3-[(4-bromothiophen-2-yl)methyl-methylamino]-1-(2-chlorophenyl)propan-1-one (PubChem CID 62642965) has the molecular formula C15H15BrClNOS and a molecular weight of 372.72 g/mol. Its IUPAC name is 3-[(4-bromothiophen-2-yl)methyl-methylamino]-1-(2-chlorophenyl)propan-1-one.
| Compound Name | 3-[(4-bromothiophen-2-yl)methyl-methylamino]-1-(2-chlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 62642965 |
| Molecular Formula | C15H15BrClNOS |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 3-[(4-bromothiophen-2-yl)methyl-methylamino]-1-(2-chlorophenyl)propan-1-one |
| SMILES | CN(CCC(=O)c1ccccc1Cl)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C15H15BrClNOS/c1-18(9-12-8-11(16)10-20-12)7-6-15(19)13-4-2-3-5-14(13)17/h2-5,8,10H,6-7,9H2,1H3 |
| InChIKey | XBGMTGLKEUIPDX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |