C15H16ClNOS — CID 55099203
1-(2-chlorophenyl)-3-[methyl(thiophen-3-ylmethyl)amino]propan-1-one (PubChem CID 55099203) has the molecular formula C15H16ClNOS and a molecular weight of 293.82 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[methyl(thiophen-3-ylmethyl)amino]propan-1-one.
| Compound Name | 1-(2-chlorophenyl)-3-[methyl(thiophen-3-ylmethyl)amino]propan-1-one |
|---|---|
| PubChem CID | 55099203 |
| Molecular Formula | C15H16ClNOS |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[methyl(thiophen-3-ylmethyl)amino]propan-1-one |
| SMILES | CN(CCC(=O)c1ccccc1Cl)Cc1ccsc1 |
| InChI | InChI=1S/C15H16ClNOS/c1-17(10-12-7-9-19-11-12)8-6-15(18)13-4-2-3-5-14(13)16/h2-5,7,9,11H,6,8,10H2,1H3 |
| InChIKey | LVFVCJHQTVIWII-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |