C11H19BrN2O2S2 — CID 79859514
N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine (PubChem CID 79859514) has the molecular formula C11H19BrN2O2S2 and a molecular weight of 355.32 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79859514 |
| Molecular Formula | C11H19BrN2O2S2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCc1cc(Br)cs1)CCS(C)(=O)=O |
| InChI | InChI=1S/C11H19BrN2O2S2/c1-14(5-6-18(2,15)16)4-3-13-8-11-7-10(12)9-17-11/h7,9,13H,3-6,8H2,1-2H3 |
| InChIKey | ZXKBYMJKRZQKHI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|