C14H16BrNO2S3 — CID 63238560
N-[(4-bromothiophen-2-yl)methyl]-2-(4-methylsulfonylphenyl)sulfanylethanamine (PubChem CID 63238560) has the molecular formula C14H16BrNO2S3 and a molecular weight of 406.39 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(4-methylsulfonylphenyl)sulfanylethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(4-methylsulfonylphenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 63238560 |
| Molecular Formula | C14H16BrNO2S3 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(4-methylsulfonylphenyl)sulfanylethanamine |
| SMILES | CS(=O)(=O)c1ccc(SCCNCc2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C14H16BrNO2S3/c1-21(17,18)14-4-2-12(3-5-14)19-7-6-16-9-13-8-11(15)10-20-13/h2-5,8,10,16H,6-7,9H2,1H3 |
| InChIKey | JLXZSZNJSVLIHK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|