C13H14BrNO2S2 — CID 47331653
N-[(4-bromothiophen-2-yl)methyl]-1-(4-methylsulfonylphenyl)methanamine (PubChem CID 47331653) has the molecular formula C13H14BrNO2S2 and a molecular weight of 360.30 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-(4-methylsulfonylphenyl)methanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-(4-methylsulfonylphenyl)methanamine |
|---|---|
| PubChem CID | 47331653 |
| Molecular Formula | C13H14BrNO2S2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-(4-methylsulfonylphenyl)methanamine |
| SMILES | CS(=O)(=O)c1ccc(CNCc2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C13H14BrNO2S2/c1-19(16,17)13-4-2-10(3-5-13)7-15-8-12-6-11(14)9-18-12/h2-6,9,15H,7-8H2,1H3 |
| InChIKey | SSKRAZLRXTUKDA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |