C16H20BrClN2OS — CID 47038944
N-[4-[[(4-bromothiophen-2-yl)methylamino]methyl]phenyl]butanamide;hydrochloride (PubChem CID 47038944) has the molecular formula C16H20BrClN2OS and a molecular weight of 403.77 g/mol. Its IUPAC name is N-[4-[[(4-bromothiophen-2-yl)methylamino]methyl]phenyl]butanamide;hydrochloride.
| Compound Name | N-[4-[[(4-bromothiophen-2-yl)methylamino]methyl]phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 47038944 |
| Molecular Formula | C16H20BrClN2OS |
| Molecular Weight | 403.77 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | N-[4-[[(4-bromothiophen-2-yl)methylamino]methyl]phenyl]butanamide;hydrochloride |
| SMILES | CCCC(=O)Nc1ccc(CNCc2cc(Br)cs2)cc1.Cl |
| InChI | InChI=1S/C16H19BrN2OS.ClH/c1-2-3-16(20)19-14-6-4-12(5-7-14)9-18-10-15-8-13(17)11-21-15;/h4-8,11,18H,2-3,9-10H2,1H3,(H,19,20);1H |
| InChIKey | LBPUMRHPRSCRFD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.77 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |