C16H28BrN3 — CID 62556567
N'-[(4-bromophenyl)methyl]-N-[2-(diethylamino)ethyl]-N'-methylethane-1,2-diamine (PubChem CID 62556567) has the molecular formula C16H28BrN3 and a molecular weight of 342.32 g/mol. Its IUPAC name is N'-[(4-bromophenyl)methyl]-N-[2-(diethylamino)ethyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[(4-bromophenyl)methyl]-N-[2-(diethylamino)ethyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62556567 |
| Molecular Formula | C16H28BrN3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N'-[(4-bromophenyl)methyl]-N-[2-(diethylamino)ethyl]-N'-methylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCN(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H28BrN3/c1-4-20(5-2)13-11-18-10-12-19(3)14-15-6-8-16(17)9-7-15/h6-9,18H,4-5,10-14H2,1-3H3 |
| InChIKey | PCIPBMWNVDUJCV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|