C17H30N2S — CID 79485681
2-[[methyl(2-thiophen-2-ylethyl)amino]methyl]-4-propan-2-ylcyclohexan-1-amine (PubChem CID 79485681) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is 2-[[methyl(2-thiophen-2-ylethyl)amino]methyl]-4-propan-2-ylcyclohexan-1-amine.
| Compound Name | 2-[[methyl(2-thiophen-2-ylethyl)amino]methyl]-4-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79485681 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-[[methyl(2-thiophen-2-ylethyl)amino]methyl]-4-propan-2-ylcyclohexan-1-amine |
| SMILES | CC(C)C1CCC(N)C(CN(C)CCc2cccs2)C1 |
| InChI | InChI=1S/C17H30N2S/c1-13(2)14-6-7-17(18)15(11-14)12-19(3)9-8-16-5-4-10-20-16/h4-5,10,13-15,17H,6-9,11-12,18H2,1-3H3 |
| InChIKey | HZXMRDPIUKWTMT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |