C15H22OS — CID 63774381
4-propan-2-yl-2-(2-thiophen-2-ylethyl)cyclohexan-1-one (PubChem CID 63774381) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is 4-propan-2-yl-2-(2-thiophen-2-ylethyl)cyclohexan-1-one.
| Compound Name | 4-propan-2-yl-2-(2-thiophen-2-ylethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 63774381 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-propan-2-yl-2-(2-thiophen-2-ylethyl)cyclohexan-1-one |
| SMILES | CC(C)C1CCC(=O)C(CCc2cccs2)C1 |
| InChI | InChI=1S/C15H22OS/c1-11(2)12-6-8-15(16)13(10-12)5-7-14-4-3-9-17-14/h3-4,9,11-13H,5-8,10H2,1-2H3 |
| InChIKey | OWPSLKYXPNLQHP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |