About (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol
(6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol (PubChem CID 59511534) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol.
Analyze (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol?
The IUPAC name of (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol (CID 59511534) is (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol.
What is the SMILES notation for (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol?
The canonical SMILES for (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol is C[C@H]1c2occc2CC[C@H]1O.
What is the InChIKey of (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol?
The InChIKey is JWSVSXGAXIGUGP-HTRCEHHLSA-N. The full InChI is InChI=1S/C9H12O2/c1-6-8(10)3-2-7-4-5-11-9(6)7/h4-6,8,10H,2-3H2,1H3/t6-,8-/m1/s1.
What are the key properties of (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol?
(6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol has a molecular weight of 152.19 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R,7R)-7-methyl-4,5,6,7-tetrahydro-1-benzofuran-6-ol is sourced from PubChem (CID 59511534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).