C13H21N — CID 142067268
N,2-dimethyl-2,3-dihydro-1H-inden-1-amine;ethane (PubChem CID 142067268) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is N,2-dimethyl-2,3-dihydro-1H-inden-1-amine;ethane.
| Compound Name | N,2-dimethyl-2,3-dihydro-1H-inden-1-amine;ethane |
|---|---|
| PubChem CID | 142067268 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N,2-dimethyl-2,3-dihydro-1H-inden-1-amine;ethane |
| SMILES | CC.CNC1c2ccccc2CC1C |
| InChI | InChI=1S/C11H15N.C2H6/c1-8-7-9-5-3-4-6-10(9)11(8)12-2;1-2/h3-6,8,11-12H,7H2,1-2H3;1-2H3 |
| InChIKey | JQAOYKFKSMTABJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |