C15H21N — CID 115889725
N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 115889725) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 115889725 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC1Cc2ccccc2C1NC1CCCC1 |
| InChI | InChI=1S/C15H21N/c1-11-10-12-6-2-5-9-14(12)15(11)16-13-7-3-4-8-13/h2,5-6,9,11,13,15-16H,3-4,7-8,10H2,1H3 |
| InChIKey | CTPDRTKPPRNLFA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |