About N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine
N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 115889725) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 115889725 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC1Cc2ccccc2C1NC1CCCC1 |
| InChI | InChI=1S/C15H21N/c1-11-10-12-6-2-5-9-14(12)15(11)16-13-7-3-4-8-13/h2,5-6,9,11,13,15-16H,3-4,7-8,10H2,1H3 |
| InChIKey | CTPDRTKPPRNLFA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine (CID 115889725) is N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine is CC1Cc2ccccc2C1NC1CCCC1.
What is the InChIKey of N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is CTPDRTKPPRNLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N/c1-11-10-12-6-2-5-9-14(12)15(11)16-13-7-3-4-8-13/h2,5-6,9,11,13,15-16H,3-4,7-8,10H2,1H3.
What are the key properties of N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine?
N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 215.34 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-methyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 115889725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).