C12H14O — CID 143306183
(5Z,7Z)-4,9-dimethyl-4,9-dihydrocycloocta[b]furan (PubChem CID 143306183) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (5Z,7Z)-4,9-dimethyl-4,9-dihydrocycloocta[b]furan.
| Compound Name | (5Z,7Z)-4,9-dimethyl-4,9-dihydrocycloocta[b]furan |
|---|---|
| PubChem CID | 143306183 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (5Z,7Z)-4,9-dimethyl-4,9-dihydrocycloocta[b]furan |
| SMILES | CC1/C=C\C=C/C(C)c2occc21 |
| InChI | InChI=1S/C12H14O/c1-9-5-3-4-6-10(2)12-11(9)7-8-13-12/h3-10H,1-2H3/b5-3-,6-4- |
| InChIKey | KMCKIMGRXZXLHB-GLIMQPGKSA-N |
| XLogP | 3.61 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |