C6H5NO2 — CID 96637935
5,6-dihydrofuro[2,3-b]pyrrol-4-one (PubChem CID 96637935) has the molecular formula C6H5NO2 and a molecular weight of 123.11 g/mol. Its IUPAC name is 5,6-dihydrofuro[2,3-b]pyrrol-4-one.
| Compound Name | 5,6-dihydrofuro[2,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 96637935 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | 5,6-dihydrofuro[2,3-b]pyrrol-4-one |
| SMILES | O=C1CNc2occc21 |
| InChI | InChI=1S/C6H5NO2/c8-5-3-7-6-4(5)1-2-9-6/h1-2,7H,3H2 |
| InChIKey | BPTJSEQWKKYKOV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |