C10H9NO2 — CID 96630355
2,3,7,8-tetrahydrofuro[3,2-g]indol-6-one (PubChem CID 96630355) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 2,3,7,8-tetrahydrofuro[3,2-g]indol-6-one.
| Compound Name | 2,3,7,8-tetrahydrofuro[3,2-g]indol-6-one |
|---|---|
| PubChem CID | 96630355 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2,3,7,8-tetrahydrofuro[3,2-g]indol-6-one |
| SMILES | O=C1CNc2c1ccc1c2OCC1 |
| InChI | InChI=1S/C10H9NO2/c12-8-5-11-9-7(8)2-1-6-3-4-13-10(6)9/h1-2,11H,3-5H2 |
| InChIKey | KZLDZNIVVPKJAT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |