C6H5NO2 — CID 96637933
1,2-dihydrofuro[3,4-b]pyrrol-3-one (PubChem CID 96637933) has the molecular formula C6H5NO2 and a molecular weight of 123.11 g/mol. Its IUPAC name is 1,2-dihydrofuro[3,4-b]pyrrol-3-one.
| Compound Name | 1,2-dihydrofuro[3,4-b]pyrrol-3-one |
|---|---|
| PubChem CID | 96637933 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | 1,2-dihydrofuro[3,4-b]pyrrol-3-one |
| SMILES | O=C1CNc2cocc21 |
| InChI | InChI=1S/C6H5NO2/c8-6-1-7-5-3-9-2-4(5)6/h2-3,7H,1H2 |
| InChIKey | UPKBKBTWAPQAJV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |