C8H7NO3 — CID 161138308
2,3-dihydro-1H-pyrano[3,4-b]pyridine-4,6-dione (PubChem CID 161138308) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrano[3,4-b]pyridine-4,6-dione.
| Compound Name | 2,3-dihydro-1H-pyrano[3,4-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 161138308 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 2,3-dihydro-1H-pyrano[3,4-b]pyridine-4,6-dione |
| SMILES | O=C1CCNc2coc(=O)cc21 |
| InChI | InChI=1S/C8H7NO3/c10-7-1-2-9-6-4-12-8(11)3-5(6)7/h3-4,9H,1-2H2 |
| InChIKey | UNCBKWDNIXLPAE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |