C12H15NO4 — CID 175847816
2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid (PubChem CID 175847816) has the molecular formula C12H15NO4 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid.
| Compound Name | 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175847816 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.O=C1CCNc2ccccc21 |
| InChI | InChI=1S/C9H9NO.C3H6O3/c11-9-5-6-10-8-4-2-1-3-7(8)9;1-2(4)3(5)6/h1-4,10H,5-6H2;2,4H,1H3,(H,5,6) |
| InChIKey | SBVVAUDJWXLYDR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |