2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid

C12H15NO4 — CID 175847816

IUPAC2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.O=C1CCNc2ccccc21
InChIInChI=1S/C9H9NO.C3H6O3/c11-9-5-6-10-8-4-2-1-3-7(8)9;1-2(4)3(5)6/h1-4,10H,5-6H2;2,4H,1H3,(H,5,6)
InChIKeySBVVAUDJWXLYDR-UHFFFAOYSA-N
MW237.26 g/mol
LogP1.14
Rot. Bonds1

About 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid

2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid (PubChem CID 175847816) has the molecular formula C12H15NO4 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid.

Molecular Properties

Compound Name2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid
PubChem CID175847816
Molecular FormulaC12H15NO4
Molecular Weight237.26 g/mol
Exact Mass237.10
IUPAC Name2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.O=C1CCNc2ccccc21
InChIInChI=1S/C9H9NO.C3H6O3/c11-9-5-6-10-8-4-2-1-3-7(8)9;1-2(4)3(5)6/h1-4,10H,5-6H2;2,4H,1H3,(H,5,6)
InChIKeySBVVAUDJWXLYDR-UHFFFAOYSA-N
XLogP1.14
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.26
LogP ≤ 51.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid?
The IUPAC name of 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid (CID 175847816) is 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid.
What is the SMILES notation for 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid?
The canonical SMILES for 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid is CC(O)C(=O)O.O=C1CCNc2ccccc21.
What is the InChIKey of 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid?
The InChIKey is SBVVAUDJWXLYDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO.C3H6O3/c11-9-5-6-10-8-4-2-1-3-7(8)9;1-2(4)3(5)6/h1-4,10H,5-6H2;2,4H,1H3,(H,5,6).
What are the key properties of 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid?
2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid has a molecular weight of 237.26 g/mol, XLogP of 1.14, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-quinolin-4-one;2-hydroxypropanoic acid is sourced from PubChem (CID 175847816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).