C10H8F3NO2 — CID 15550363
6-(trifluoromethoxy)-2,3-dihydro-1H-quinolin-4-one (PubChem CID 15550363) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 6-(trifluoromethoxy)-2,3-dihydro-1H-quinolin-4-one.
| Compound Name | 6-(trifluoromethoxy)-2,3-dihydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 15550363 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 6-(trifluoromethoxy)-2,3-dihydro-1H-quinolin-4-one |
| SMILES | O=C1CCNc2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C10H8F3NO2/c11-10(12,13)16-6-1-2-8-7(5-6)9(15)3-4-14-8/h1-2,5,14H,3-4H2 |
| InChIKey | CJHGCIGFBKWVHO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|