C9H8F3NOS — CID 15550365
7-(trifluoromethoxy)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 15550365) has the molecular formula C9H8F3NOS and a molecular weight of 235.23 g/mol. Its IUPAC name is 7-(trifluoromethoxy)-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 7-(trifluoromethoxy)-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 15550365 |
| Molecular Formula | C9H8F3NOS |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 7-(trifluoromethoxy)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | FC(F)(F)Oc1ccc2c(c1)SCCN2 |
| InChI | InChI=1S/C9H8F3NOS/c10-9(11,12)14-6-1-2-7-8(5-6)15-4-3-13-7/h1-2,5,13H,3-4H2 |
| InChIKey | TWPWHKKTXVEKRF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|