C11H9F3O2S — CID 127264118
8-(trifluoromethoxy)-3,4-dihydro-2H-1-benzothiepin-5-one (PubChem CID 127264118) has the molecular formula C11H9F3O2S and a molecular weight of 262.25 g/mol. Its IUPAC name is 8-(trifluoromethoxy)-3,4-dihydro-2H-1-benzothiepin-5-one.
| Compound Name | 8-(trifluoromethoxy)-3,4-dihydro-2H-1-benzothiepin-5-one |
|---|---|
| PubChem CID | 127264118 |
| Molecular Formula | C11H9F3O2S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 8-(trifluoromethoxy)-3,4-dihydro-2H-1-benzothiepin-5-one |
| SMILES | O=C1CCCSc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C11H9F3O2S/c12-11(13,14)16-7-3-4-8-9(15)2-1-5-17-10(8)6-7/h3-4,6H,1-2,5H2 |
| InChIKey | AIYVFKVOYQELNQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |