C16H11F3O3 — CID 169422666
7-[3-(trifluoromethoxy)phenyl]-2,3-dihydrochromen-4-one (PubChem CID 169422666) has the molecular formula C16H11F3O3 and a molecular weight of 308.25 g/mol. Its IUPAC name is 7-[3-(trifluoromethoxy)phenyl]-2,3-dihydrochromen-4-one.
| Compound Name | 7-[3-(trifluoromethoxy)phenyl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 169422666 |
| Molecular Formula | C16H11F3O3 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 7-[3-(trifluoromethoxy)phenyl]-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2cc(-c3cccc(OC(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C16H11F3O3/c17-16(18,19)22-12-3-1-2-10(8-12)11-4-5-13-14(20)6-7-21-15(13)9-11/h1-5,8-9H,6-7H2 |
| InChIKey | WPEJANKSJOCXPL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |