C17H13F3O2 — CID 169410326
6-[2-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 169410326) has the molecular formula C17H13F3O2 and a molecular weight of 306.28 g/mol. Its IUPAC name is 6-[2-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-[2-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 169410326 |
| Molecular Formula | C17H13F3O2 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 6-[2-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2cc(-c3ccccc3OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H13F3O2/c18-17(19,20)22-16-7-2-1-5-14(16)12-8-9-13-11(10-12)4-3-6-15(13)21/h1-2,5,7-10H,3-4,6H2 |
| InChIKey | AKQLKNQBUIKPTI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |