C9H10O2 — CID 112714113
5,5-dimethyl-4H-cyclopenta[b]furan-6-one (PubChem CID 112714113) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 5,5-dimethyl-4H-cyclopenta[b]furan-6-one.
| Compound Name | 5,5-dimethyl-4H-cyclopenta[b]furan-6-one |
|---|---|
| PubChem CID | 112714113 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 5,5-dimethyl-4H-cyclopenta[b]furan-6-one |
| SMILES | CC1(C)Cc2ccoc2C1=O |
| InChI | InChI=1S/C9H10O2/c1-9(2)5-6-3-4-11-7(6)8(9)10/h3-4H,5H2,1-2H3 |
| InChIKey | XZSJLAFZHNITNO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |