C16H20O2 — CID 11230293
(5aR,7R,9aS)-9a-methyl-7-prop-1-en-2-yl-4,5,5a,6,7,8-hexahydrobenzo[g][1]benzofuran-9-one (PubChem CID 11230293) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (5aR,7R,9aS)-9a-methyl-7-prop-1-en-2-yl-4,5,5a,6,7,8-hexahydrobenzo[g][1]benzofuran-9-one.
| Compound Name | (5aR,7R,9aS)-9a-methyl-7-prop-1-en-2-yl-4,5,5a,6,7,8-hexahydrobenzo[g][1]benzofuran-9-one |
|---|---|
| PubChem CID | 11230293 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (5aR,7R,9aS)-9a-methyl-7-prop-1-en-2-yl-4,5,5a,6,7,8-hexahydrobenzo[g][1]benzofuran-9-one |
| SMILES | C=C(C)[C@H]1CC(=O)[C@]2(C)c3occc3CC[C@@H]2C1 |
| InChI | InChI=1S/C16H20O2/c1-10(2)12-8-13-5-4-11-6-7-18-15(11)16(13,3)14(17)9-12/h6-7,12-13H,1,4-5,8-9H2,2-3H3/t12-,13-,16-/m1/s1 |
| InChIKey | UWTHCWBGGDHHIP-XJKCOSOUSA-N |
| XLogP | 3.65 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|