C23H38O3Si — CID 101356463
(3aS,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-methoxyprop-1-enyl]-3a-methyl-6-prop-1-en-2-yl-5,6,7,7a-tetrahydro-1H-inden-4-one (PubChem CID 101356463) has the molecular formula C23H38O3Si and a molecular weight of 390.64 g/mol. Its IUPAC name is (3aS,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-methoxyprop-1-enyl]-3a-methyl-6-prop-1-en-2-yl-5,6,7,7a-tetrahydro-1H-inden-4-one.
| Compound Name | (3aS,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-methoxyprop-1-enyl]-3a-methyl-6-prop-1-en-2-yl-5,6,7,7a-tetrahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 101356463 |
| Molecular Formula | C23H38O3Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (3aS,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-methoxyprop-1-enyl]-3a-methyl-6-prop-1-en-2-yl-5,6,7,7a-tetrahydro-1H-inden-4-one |
| SMILES | C=C(C)[C@H]1CC(=O)[C@]2(C)C(O[Si](C)(C)C(C)(C)C)=C(/C=C(/C)OC)CC2C1 |
| InChI | InChI=1S/C23H38O3Si/c1-15(2)17-12-19-13-18(11-16(3)25-8)21(23(19,7)20(24)14-17)26-27(9,10)22(4,5)6/h11,17,19H,1,12-14H2,2-10H3/b16-11-/t17-,19?,23-/m1/s1 |
| InChIKey | UMLGRNFZVDTHLY-XGMZWJCPSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|